C26H41ClO4Si2 — CID 160501049
tert-butyl-chloro-dimethylsilane;3-[tert-butyl(dimethyl)silyl]oxybenzaldehyde;3-hydroxybenzaldehyde (PubChem CID 160501049) has the molecular formula C26H41ClO4Si2 and a molecular weight of 509.24 g/mol. Its IUPAC name is tert-butyl-chloro-dimethylsilane;3-[tert-butyl(dimethyl)silyl]oxybenzaldehyde;3-hydroxybenzaldehyde.
| Compound Name | tert-butyl-chloro-dimethylsilane;3-[tert-butyl(dimethyl)silyl]oxybenzaldehyde;3-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 160501049 |
| Molecular Formula | C26H41ClO4Si2 |
| Molecular Weight | 509.24 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | tert-butyl-chloro-dimethylsilane;3-[tert-butyl(dimethyl)silyl]oxybenzaldehyde;3-hydroxybenzaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)Cl.CC(C)(C)[Si](C)(C)Oc1cccc(C=O)c1.O=Cc1cccc(O)c1 |
| InChI | InChI=1S/C13H20O2Si.C7H6O2.C6H15ClSi/c1-13(2,3)16(4,5)15-12-8-6-7-11(9-12)10-14;8-5-6-2-1-3-7(9)4-6;1-6(2,3)8(4,5)7/h6-10H,1-5H3;1-5,9H;1-5H3 |
| InChIKey | QRUAGXXXNOPAMY-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.24 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|