C27H46O4Si2 — CID 159275169
[4-[tert-butyl(dimethyl)silyl]oxyphenyl]methanol;tert-butyl(trimethyl)silane;4-hydroxybenzaldehyde (PubChem CID 159275169) has the molecular formula C27H46O4Si2 and a molecular weight of 490.83 g/mol. Its IUPAC name is [4-[tert-butyl(dimethyl)silyl]oxyphenyl]methanol;tert-butyl(trimethyl)silane;4-hydroxybenzaldehyde.
| Compound Name | [4-[tert-butyl(dimethyl)silyl]oxyphenyl]methanol;tert-butyl(trimethyl)silane;4-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 159275169 |
| Molecular Formula | C27H46O4Si2 |
| Molecular Weight | 490.83 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | [4-[tert-butyl(dimethyl)silyl]oxyphenyl]methanol;tert-butyl(trimethyl)silane;4-hydroxybenzaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)C.CC(C)(C)[Si](C)(C)Oc1ccc(CO)cc1.O=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C13H22O2Si.C7H6O2.C7H18Si/c1-13(2,3)16(4,5)15-12-8-6-11(10-14)7-9-12;8-5-6-1-3-7(9)4-2-6;1-7(2,3)8(4,5)6/h6-9,14H,10H2,1-5H3;1-5,9H;1-6H3 |
| InChIKey | KYFGWCTZOUHIBV-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.83 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|