About ethanol;4-hydroxybenzaldehyde
ethanol;4-hydroxybenzaldehyde (PubChem CID 172788634) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is ethanol;4-hydroxybenzaldehyde.
Molecular Properties
| Compound Name | ethanol;4-hydroxybenzaldehyde |
| PubChem CID | 172788634 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | ethanol;4-hydroxybenzaldehyde |
| SMILES | CCO.O=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C7H6O2.C2H6O/c8-5-6-1-3-7(9)4-2-6;1-2-3/h1-5,9H;3H,2H2,1H3 |
| InChIKey | PGFSTEOEDQOZOK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethanol;4-hydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;4-hydroxybenzaldehyde?
The IUPAC name of ethanol;4-hydroxybenzaldehyde (CID 172788634) is ethanol;4-hydroxybenzaldehyde.
What is the SMILES notation for ethanol;4-hydroxybenzaldehyde?
The canonical SMILES for ethanol;4-hydroxybenzaldehyde is CCO.O=Cc1ccc(O)cc1.
What is the InChIKey of ethanol;4-hydroxybenzaldehyde?
The InChIKey is PGFSTEOEDQOZOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C2H6O/c8-5-6-1-3-7(9)4-2-6;1-2-3/h1-5,9H;3H,2H2,1H3.
What are the key properties of ethanol;4-hydroxybenzaldehyde?
ethanol;4-hydroxybenzaldehyde has a molecular weight of 168.19 g/mol, XLogP of 1.20, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;4-hydroxybenzaldehyde is sourced from PubChem (CID 172788634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).