About 2,6-dimethylbenzaldehyde;4-hydroxybenzaldehyde
2,6-dimethylbenzaldehyde;4-hydroxybenzaldehyde (PubChem CID 158794546) has the molecular formula C16H16O3
and a molecular weight of 256.30 g/mol. Its IUPAC name is 2,6-dimethylbenzaldehyde;4-hydroxybenzaldehyde.
Molecular Properties
| Compound Name | 2,6-dimethylbenzaldehyde;4-hydroxybenzaldehyde |
| PubChem CID | 158794546 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2,6-dimethylbenzaldehyde;4-hydroxybenzaldehyde |
| SMILES | Cc1cccc(C)c1C=O.O=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C9H10O.C7H6O2/c1-7-4-3-5-8(2)9(7)6-10;8-5-6-1-3-7(9)4-2-6/h3-6H,1-2H3;1-5,9H |
| InChIKey | ISRYBTXQMYXRDL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethylbenzaldehyde;4-hydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylbenzaldehyde;4-hydroxybenzaldehyde?
The IUPAC name of 2,6-dimethylbenzaldehyde;4-hydroxybenzaldehyde (CID 158794546) is 2,6-dimethylbenzaldehyde;4-hydroxybenzaldehyde.
What is the SMILES notation for 2,6-dimethylbenzaldehyde;4-hydroxybenzaldehyde?
The canonical SMILES for 2,6-dimethylbenzaldehyde;4-hydroxybenzaldehyde is Cc1cccc(C)c1C=O.O=Cc1ccc(O)cc1.
What is the InChIKey of 2,6-dimethylbenzaldehyde;4-hydroxybenzaldehyde?
The InChIKey is ISRYBTXQMYXRDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O.C7H6O2/c1-7-4-3-5-8(2)9(7)6-10;8-5-6-1-3-7(9)4-2-6/h3-6H,1-2H3;1-5,9H.
What are the key properties of 2,6-dimethylbenzaldehyde;4-hydroxybenzaldehyde?
2,6-dimethylbenzaldehyde;4-hydroxybenzaldehyde has a molecular weight of 256.30 g/mol, XLogP of 3.32, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylbenzaldehyde;4-hydroxybenzaldehyde is sourced from PubChem (CID 158794546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).