About chloroethane;4-hydroxybenzaldehyde
chloroethane;4-hydroxybenzaldehyde (PubChem CID 174574301) has the molecular formula C9H11ClO2
and a molecular weight of 186.64 g/mol. Its IUPAC name is chloroethane;4-hydroxybenzaldehyde.
Molecular Properties
| Compound Name | chloroethane;4-hydroxybenzaldehyde |
| PubChem CID | 174574301 |
| Molecular Formula | C9H11ClO2 |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | chloroethane;4-hydroxybenzaldehyde |
| SMILES | CCCl.O=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C7H6O2.C2H5Cl/c8-5-6-1-3-7(9)4-2-6;1-2-3/h1-5,9H;2H2,1H3 |
| InChIKey | XUBBUWOEQQKCLN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloroethane;4-hydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroethane;4-hydroxybenzaldehyde?
The IUPAC name of chloroethane;4-hydroxybenzaldehyde (CID 174574301) is chloroethane;4-hydroxybenzaldehyde.
What is the SMILES notation for chloroethane;4-hydroxybenzaldehyde?
The canonical SMILES for chloroethane;4-hydroxybenzaldehyde is CCCl.O=Cc1ccc(O)cc1.
What is the InChIKey of chloroethane;4-hydroxybenzaldehyde?
The InChIKey is XUBBUWOEQQKCLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C2H5Cl/c8-5-6-1-3-7(9)4-2-6;1-2-3/h1-5,9H;2H2,1H3.
What are the key properties of chloroethane;4-hydroxybenzaldehyde?
chloroethane;4-hydroxybenzaldehyde has a molecular weight of 186.64 g/mol, XLogP of 2.45, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloroethane;4-hydroxybenzaldehyde is sourced from PubChem (CID 174574301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).