About 4-hydroxybenzaldehyde;1-(2-hydroxyphenyl)butan-2-one
4-hydroxybenzaldehyde;1-(2-hydroxyphenyl)butan-2-one (PubChem CID 174470153) has the molecular formula C17H18O4
and a molecular weight of 286.33 g/mol. Its IUPAC name is 4-hydroxybenzaldehyde;1-(2-hydroxyphenyl)butan-2-one.
Molecular Properties
| Compound Name | 4-hydroxybenzaldehyde;1-(2-hydroxyphenyl)butan-2-one |
| PubChem CID | 174470153 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 4-hydroxybenzaldehyde;1-(2-hydroxyphenyl)butan-2-one |
| SMILES | CCC(=O)Cc1ccccc1O.O=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C10H12O2.C7H6O2/c1-2-9(11)7-8-5-3-4-6-10(8)12;8-5-6-1-3-7(9)4-2-6/h3-6,12H,2,7H2,1H3;1-5,9H |
| InChIKey | WEPHEMCBTOBGPP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxybenzaldehyde;1-(2-hydroxyphenyl)butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybenzaldehyde;1-(2-hydroxyphenyl)butan-2-one?
The IUPAC name of 4-hydroxybenzaldehyde;1-(2-hydroxyphenyl)butan-2-one (CID 174470153) is 4-hydroxybenzaldehyde;1-(2-hydroxyphenyl)butan-2-one.
What is the SMILES notation for 4-hydroxybenzaldehyde;1-(2-hydroxyphenyl)butan-2-one?
The canonical SMILES for 4-hydroxybenzaldehyde;1-(2-hydroxyphenyl)butan-2-one is CCC(=O)Cc1ccccc1O.O=Cc1ccc(O)cc1.
What is the InChIKey of 4-hydroxybenzaldehyde;1-(2-hydroxyphenyl)butan-2-one?
The InChIKey is WEPHEMCBTOBGPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2.C7H6O2/c1-2-9(11)7-8-5-3-4-6-10(8)12;8-5-6-1-3-7(9)4-2-6/h3-6,12H,2,7H2,1H3;1-5,9H.
What are the key properties of 4-hydroxybenzaldehyde;1-(2-hydroxyphenyl)butan-2-one?
4-hydroxybenzaldehyde;1-(2-hydroxyphenyl)butan-2-one has a molecular weight of 286.33 g/mol, XLogP of 3.12, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybenzaldehyde;1-(2-hydroxyphenyl)butan-2-one is sourced from PubChem (CID 174470153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).