About benzaldehyde;2-[2-(2-hydroxyethyl)phenyl]ethanol;phenol
benzaldehyde;2-[2-(2-hydroxyethyl)phenyl]ethanol;phenol (PubChem CID 174235239) has the molecular formula C23H26O4
and a molecular weight of 366.46 g/mol. Its IUPAC name is benzaldehyde;2-[2-(2-hydroxyethyl)phenyl]ethanol;phenol.
Molecular Properties
| Compound Name | benzaldehyde;2-[2-(2-hydroxyethyl)phenyl]ethanol;phenol |
| PubChem CID | 174235239 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | benzaldehyde;2-[2-(2-hydroxyethyl)phenyl]ethanol;phenol |
| SMILES | O=Cc1ccccc1.OCCc1ccccc1CCO.Oc1ccccc1 |
| InChI | InChI=1S/C10H14O2.C7H6O.C6H6O/c11-7-5-9-3-1-2-4-10(9)6-8-12;8-6-7-4-2-1-3-5-7;7-6-4-2-1-3-5-6/h1-4,11-12H,5-8H2;1-6H;1-5,7H |
| InChIKey | IHJLVIRBWKBWJB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze benzaldehyde;2-[2-(2-hydroxyethyl)phenyl]ethanol;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzaldehyde;2-[2-(2-hydroxyethyl)phenyl]ethanol;phenol?
The IUPAC name of benzaldehyde;2-[2-(2-hydroxyethyl)phenyl]ethanol;phenol (CID 174235239) is benzaldehyde;2-[2-(2-hydroxyethyl)phenyl]ethanol;phenol.
What is the SMILES notation for benzaldehyde;2-[2-(2-hydroxyethyl)phenyl]ethanol;phenol?
The canonical SMILES for benzaldehyde;2-[2-(2-hydroxyethyl)phenyl]ethanol;phenol is O=Cc1ccccc1.OCCc1ccccc1CCO.Oc1ccccc1.
What is the InChIKey of benzaldehyde;2-[2-(2-hydroxyethyl)phenyl]ethanol;phenol?
The InChIKey is IHJLVIRBWKBWJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2.C7H6O.C6H6O/c11-7-5-9-3-1-2-4-10(9)6-8-12;8-6-7-4-2-1-3-5-7;7-6-4-2-1-3-5-6/h1-4,11-12H,5-8H2;1-6H;1-5,7H.
What are the key properties of benzaldehyde;2-[2-(2-hydroxyethyl)phenyl]ethanol;phenol?
benzaldehyde;2-[2-(2-hydroxyethyl)phenyl]ethanol;phenol has a molecular weight of 366.46 g/mol, XLogP of 3.65, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzaldehyde;2-[2-(2-hydroxyethyl)phenyl]ethanol;phenol is sourced from PubChem (CID 174235239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).