C16H18O4 — CID 174730907
4-hydroxybenzaldehyde;1-phenylpropane-1,1-diol (PubChem CID 174730907) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is 4-hydroxybenzaldehyde;1-phenylpropane-1,1-diol.
| Compound Name | 4-hydroxybenzaldehyde;1-phenylpropane-1,1-diol |
|---|---|
| PubChem CID | 174730907 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 4-hydroxybenzaldehyde;1-phenylpropane-1,1-diol |
| SMILES | CCC(O)(O)c1ccccc1.O=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C9H12O2.C7H6O2/c1-2-9(10,11)8-6-4-3-5-7-8;8-5-6-1-3-7(9)4-2-6/h3-7,10-11H,2H2,1H3;1-5,9H |
| InChIKey | JGXLDMYOZVJOHB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|