C10H14O5 — CID 158239997
carbonic acid;1-phenylpropane-1,1-diol (PubChem CID 158239997) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is carbonic acid;1-phenylpropane-1,1-diol.
| Compound Name | carbonic acid;1-phenylpropane-1,1-diol |
|---|---|
| PubChem CID | 158239997 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | carbonic acid;1-phenylpropane-1,1-diol |
| SMILES | CCC(O)(O)c1ccccc1.O=C(O)O |
| InChI | InChI=1S/C9H12O2.CH2O3/c1-2-9(10,11)8-6-4-3-5-7-8;2-1(3)4/h3-7,10-11H,2H2,1H3;(H2,2,3,4) |
| InChIKey | GFKVFUMVTMBYLD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|