C30H28O2 — CID 13396368
4-hydroxy-1,1,1,4-tetraphenylhexan-2-one (PubChem CID 13396368) has the molecular formula C30H28O2 and a molecular weight of 420.55 g/mol. Its IUPAC name is 4-hydroxy-1,1,1,4-tetraphenylhexan-2-one.
| Compound Name | 4-hydroxy-1,1,1,4-tetraphenylhexan-2-one |
|---|---|
| PubChem CID | 13396368 |
| Molecular Formula | C30H28O2 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 4-hydroxy-1,1,1,4-tetraphenylhexan-2-one |
| SMILES | CCC(O)(CC(=O)C(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H28O2/c1-2-29(32,24-15-7-3-8-16-24)23-28(31)30(25-17-9-4-10-18-25,26-19-11-5-12-20-26)27-21-13-6-14-22-27/h3-22,32H,2,23H2,1H3 |
| InChIKey | NXAVVZVHWWHAJM-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|