C15H23NO3 — CID 174768903
azepan-2-one;1-phenylpropane-1,1-diol (PubChem CID 174768903) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is azepan-2-one;1-phenylpropane-1,1-diol.
| Compound Name | azepan-2-one;1-phenylpropane-1,1-diol |
|---|---|
| PubChem CID | 174768903 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | azepan-2-one;1-phenylpropane-1,1-diol |
| SMILES | CCC(O)(O)c1ccccc1.O=C1CCCCCN1 |
| InChI | InChI=1S/C9H12O2.C6H11NO/c1-2-9(10,11)8-6-4-3-5-7-8;8-6-4-2-1-3-5-7-6/h3-7,10-11H,2H2,1H3;1-5H2,(H,7,8) |
| InChIKey | ITINAPXWCSBZHM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|