C13H24O6P+ — CID 174332580
1-phenylpropane-1,1-diol;tetrakis(hydroxymethyl)phosphanium (PubChem CID 174332580) has the molecular formula C13H24O6P+ and a molecular weight of 307.30 g/mol. Its IUPAC name is 1-phenylpropane-1,1-diol;tetrakis(hydroxymethyl)phosphanium.
| Compound Name | 1-phenylpropane-1,1-diol;tetrakis(hydroxymethyl)phosphanium |
|---|---|
| PubChem CID | 174332580 |
| Molecular Formula | C13H24O6P+ |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 1-phenylpropane-1,1-diol;tetrakis(hydroxymethyl)phosphanium |
| SMILES | CCC(O)(O)c1ccccc1.OC[P+](CO)(CO)CO |
| InChI | InChI=1S/C9H12O2.C4H12O4P/c1-2-9(10,11)8-6-4-3-5-7-8;5-1-9(2-6,3-7)4-8/h3-7,10-11H,2H2,1H3;5-8H,1-4H2/q;+1 |
| InChIKey | WZAXRFBUPXUKJW-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|