C15H19NO2 — CID 159835517
aniline;1-phenylpropane-1,1-diol (PubChem CID 159835517) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is aniline;1-phenylpropane-1,1-diol.
| Compound Name | aniline;1-phenylpropane-1,1-diol |
|---|---|
| PubChem CID | 159835517 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | aniline;1-phenylpropane-1,1-diol |
| SMILES | CCC(O)(O)c1ccccc1.Nc1ccccc1 |
| InChI | InChI=1S/C9H12O2.C6H7N/c1-2-9(10,11)8-6-4-3-5-7-8;7-6-4-2-1-3-5-6/h3-7,10-11H,2H2,1H3;1-5H,7H2 |
| InChIKey | NOACLMYUJZAGKU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|