C12H21NO2 — CID 174954079
aniline;2,3-dimethylbutane-2,3-diol (PubChem CID 174954079) has the molecular formula C12H21NO2 and a molecular weight of 211.31 g/mol. Its IUPAC name is aniline;2,3-dimethylbutane-2,3-diol.
| Compound Name | aniline;2,3-dimethylbutane-2,3-diol |
|---|---|
| PubChem CID | 174954079 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | aniline;2,3-dimethylbutane-2,3-diol |
| SMILES | CC(C)(O)C(C)(C)O.Nc1ccccc1 |
| InChI | InChI=1S/C6H7N.C6H14O2/c7-6-4-2-1-3-5-6;1-5(2,7)6(3,4)8/h1-5H,7H2;7-8H,1-4H3 |
| InChIKey | MTDRPHLSNBVDTG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|