About acetic acid;4-hydroxybenzaldehyde
acetic acid;4-hydroxybenzaldehyde (PubChem CID 86610069) has the molecular formula C9H10O4
and a molecular weight of 182.17 g/mol. Its IUPAC name is acetic acid;4-hydroxybenzaldehyde.
Molecular Properties
| Compound Name | acetic acid;4-hydroxybenzaldehyde |
| PubChem CID | 86610069 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | acetic acid;4-hydroxybenzaldehyde |
| SMILES | CC(=O)O.O=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C7H6O2.C2H4O2/c8-5-6-1-3-7(9)4-2-6;1-2(3)4/h1-5,9H;1H3,(H,3,4) |
| InChIKey | UWOKKZLYDFUSNF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;4-hydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;4-hydroxybenzaldehyde?
The IUPAC name of acetic acid;4-hydroxybenzaldehyde (CID 86610069) is acetic acid;4-hydroxybenzaldehyde.
What is the SMILES notation for acetic acid;4-hydroxybenzaldehyde?
The canonical SMILES for acetic acid;4-hydroxybenzaldehyde is CC(=O)O.O=Cc1ccc(O)cc1.
What is the InChIKey of acetic acid;4-hydroxybenzaldehyde?
The InChIKey is UWOKKZLYDFUSNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C2H4O2/c8-5-6-1-3-7(9)4-2-6;1-2(3)4/h1-5,9H;1H3,(H,3,4).
What are the key properties of acetic acid;4-hydroxybenzaldehyde?
acetic acid;4-hydroxybenzaldehyde has a molecular weight of 182.17 g/mol, XLogP of 1.30, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;4-hydroxybenzaldehyde is sourced from PubChem (CID 86610069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).