C17H18O7 — CID 157275150
4-hydroxybenzaldehyde;2,4,5-trimethoxybenzoic acid (PubChem CID 157275150) has the molecular formula C17H18O7 and a molecular weight of 334.32 g/mol. Its IUPAC name is 4-hydroxybenzaldehyde;2,4,5-trimethoxybenzoic acid.
| Compound Name | 4-hydroxybenzaldehyde;2,4,5-trimethoxybenzoic acid |
|---|---|
| PubChem CID | 157275150 |
| Molecular Formula | C17H18O7 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 4-hydroxybenzaldehyde;2,4,5-trimethoxybenzoic acid |
| SMILES | COc1cc(OC)c(C(=O)O)cc1OC.O=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C10H12O5.C7H6O2/c1-13-7-5-9(15-3)8(14-2)4-6(7)10(11)12;8-5-6-1-3-7(9)4-2-6/h4-5H,1-3H3,(H,11,12);1-5,9H |
| InChIKey | AYZXFIGYMBHPKN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|