4-hydroxybenzaldehyde;2,4,5-trimethoxybenzoic acid

C17H18O7 — CID 157275150

IUPAC4-hydroxybenzaldehyde;2,4,5-trimethoxybenzoic acid
SMILESCOc1cc(OC)c(C(=O)O)cc1OC.O=Cc1ccc(O)cc1
InChIInChI=1S/C10H12O5.C7H6O2/c1-13-7-5-9(15-3)8(14-2)4-6(7)10(11)12;8-5-6-1-3-7(9)4-2-6/h4-5H,1-3H3,(H,11,12);1-5,9H
InChIKeyAYZXFIGYMBHPKN-UHFFFAOYSA-N
MW334.32 g/mol
LogP2.62
Rot. Bonds5

About 4-hydroxybenzaldehyde;2,4,5-trimethoxybenzoic acid

4-hydroxybenzaldehyde;2,4,5-trimethoxybenzoic acid (PubChem CID 157275150) has the molecular formula C17H18O7 and a molecular weight of 334.32 g/mol. Its IUPAC name is 4-hydroxybenzaldehyde;2,4,5-trimethoxybenzoic acid.

Molecular Properties

Compound Name4-hydroxybenzaldehyde;2,4,5-trimethoxybenzoic acid
PubChem CID157275150
Molecular FormulaC17H18O7
Molecular Weight334.32 g/mol
Exact Mass334.11
IUPAC Name4-hydroxybenzaldehyde;2,4,5-trimethoxybenzoic acid
SMILESCOc1cc(OC)c(C(=O)O)cc1OC.O=Cc1ccc(O)cc1
InChIInChI=1S/C10H12O5.C7H6O2/c1-13-7-5-9(15-3)8(14-2)4-6(7)10(11)12;8-5-6-1-3-7(9)4-2-6/h4-5H,1-3H3,(H,11,12);1-5,9H
InChIKeyAYZXFIGYMBHPKN-UHFFFAOYSA-N
XLogP2.62
TPSA102.29 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500334.32
LogP ≤ 52.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 4-hydroxybenzaldehyde;2,4,5-trimethoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-hydroxybenzaldehyde;2,4,5-trimethoxybenzoic acid?
The IUPAC name of 4-hydroxybenzaldehyde;2,4,5-trimethoxybenzoic acid (CID 157275150) is 4-hydroxybenzaldehyde;2,4,5-trimethoxybenzoic acid.
What is the SMILES notation for 4-hydroxybenzaldehyde;2,4,5-trimethoxybenzoic acid?
The canonical SMILES for 4-hydroxybenzaldehyde;2,4,5-trimethoxybenzoic acid is COc1cc(OC)c(C(=O)O)cc1OC.O=Cc1ccc(O)cc1.
What is the InChIKey of 4-hydroxybenzaldehyde;2,4,5-trimethoxybenzoic acid?
The InChIKey is AYZXFIGYMBHPKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O5.C7H6O2/c1-13-7-5-9(15-3)8(14-2)4-6(7)10(11)12;8-5-6-1-3-7(9)4-2-6/h4-5H,1-3H3,(H,11,12);1-5,9H.
What are the key properties of 4-hydroxybenzaldehyde;2,4,5-trimethoxybenzoic acid?
4-hydroxybenzaldehyde;2,4,5-trimethoxybenzoic acid has a molecular weight of 334.32 g/mol, XLogP of 2.62, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybenzaldehyde;2,4,5-trimethoxybenzoic acid is sourced from PubChem (CID 157275150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).