C20H24O7 — CID 162265472
2,4-dimethoxy-5-methylbenzaldehyde;2,4-dimethoxy-5-methylbenzoic acid (PubChem CID 162265472) has the molecular formula C20H24O7 and a molecular weight of 376.41 g/mol. Its IUPAC name is 2,4-dimethoxy-5-methylbenzaldehyde;2,4-dimethoxy-5-methylbenzoic acid.
| Compound Name | 2,4-dimethoxy-5-methylbenzaldehyde;2,4-dimethoxy-5-methylbenzoic acid |
|---|---|
| PubChem CID | 162265472 |
| Molecular Formula | C20H24O7 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2,4-dimethoxy-5-methylbenzaldehyde;2,4-dimethoxy-5-methylbenzoic acid |
| SMILES | COc1cc(OC)c(C(=O)O)cc1C.COc1cc(OC)c(C=O)cc1C |
| InChI | InChI=1S/C10H12O4.C10H12O3/c1-6-4-7(10(11)12)9(14-3)5-8(6)13-2;1-7-4-8(6-11)10(13-3)5-9(7)12-2/h4-5H,1-3H3,(H,11,12);4-6H,1-3H3 |
| InChIKey | ZZVQYPBKQKSDTI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|