C10H11BrO2 — CID 116924546
2-methoxy-4,5-dimethylbenzoyl bromide (PubChem CID 116924546) has the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. Its IUPAC name is 2-methoxy-4,5-dimethylbenzoyl bromide.
| Compound Name | 2-methoxy-4,5-dimethylbenzoyl bromide |
|---|---|
| PubChem CID | 116924546 |
| Molecular Formula | C10H11BrO2 |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 2-methoxy-4,5-dimethylbenzoyl bromide |
| SMILES | COc1cc(C)c(C)cc1C(=O)Br |
| InChI | InChI=1S/C10H11BrO2/c1-6-4-8(10(11)12)9(13-3)5-7(6)2/h4-5H,1-3H3 |
| InChIKey | CZKROWPFRVQGRY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|