C10H11BrO3 — CID 116924582
4,5-dimethoxy-2-methylbenzoyl bromide (PubChem CID 116924582) has the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. Its IUPAC name is 4,5-dimethoxy-2-methylbenzoyl bromide.
| Compound Name | 4,5-dimethoxy-2-methylbenzoyl bromide |
|---|---|
| PubChem CID | 116924582 |
| Molecular Formula | C10H11BrO3 |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 4,5-dimethoxy-2-methylbenzoyl bromide |
| SMILES | COc1cc(C)c(C(=O)Br)cc1OC |
| InChI | InChI=1S/C10H11BrO3/c1-6-4-8(13-2)9(14-3)5-7(6)10(11)12/h4-5H,1-3H3 |
| InChIKey | CAWQPRJPXYAVOZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|