C17H17BrO3 — CID 43626572
2-(4-bromophenyl)-1-(4,5-dimethoxy-2-methylphenyl)ethanone (PubChem CID 43626572) has the molecular formula C17H17BrO3 and a molecular weight of 349.22 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-(4,5-dimethoxy-2-methylphenyl)ethanone.
| Compound Name | 2-(4-bromophenyl)-1-(4,5-dimethoxy-2-methylphenyl)ethanone |
|---|---|
| PubChem CID | 43626572 |
| Molecular Formula | C17H17BrO3 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 2-(4-bromophenyl)-1-(4,5-dimethoxy-2-methylphenyl)ethanone |
| SMILES | COc1cc(C)c(C(=O)Cc2ccc(Br)cc2)cc1OC |
| InChI | InChI=1S/C17H17BrO3/c1-11-8-16(20-2)17(21-3)10-14(11)15(19)9-12-4-6-13(18)7-5-12/h4-8,10H,9H2,1-3H3 |
| InChIKey | TWQITHNKBYAZJY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |