C16H14Br2O3 — CID 105056472
1-(4-bromo-2,5-dimethoxyphenyl)-2-(4-bromophenyl)ethanone (PubChem CID 105056472) has the molecular formula C16H14Br2O3 and a molecular weight of 414.09 g/mol. Its IUPAC name is 1-(4-bromo-2,5-dimethoxyphenyl)-2-(4-bromophenyl)ethanone.
| Compound Name | 1-(4-bromo-2,5-dimethoxyphenyl)-2-(4-bromophenyl)ethanone |
|---|---|
| PubChem CID | 105056472 |
| Molecular Formula | C16H14Br2O3 |
| Molecular Weight | 414.09 g/mol |
| Exact Mass | 411.93 |
| IUPAC Name | 1-(4-bromo-2,5-dimethoxyphenyl)-2-(4-bromophenyl)ethanone |
| SMILES | COc1cc(C(=O)Cc2ccc(Br)cc2)c(OC)cc1Br |
| InChI | InChI=1S/C16H14Br2O3/c1-20-15-9-13(18)16(21-2)8-12(15)14(19)7-10-3-5-11(17)6-4-10/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | AUMLXMDEVPDTSP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.09 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |