C15H11BrCl2O2 — CID 114964656
2-(3-bromo-4-methoxyphenyl)-1-(2,5-dichlorophenyl)ethanone (PubChem CID 114964656) has the molecular formula C15H11BrCl2O2 and a molecular weight of 374.06 g/mol. Its IUPAC name is 2-(3-bromo-4-methoxyphenyl)-1-(2,5-dichlorophenyl)ethanone.
| Compound Name | 2-(3-bromo-4-methoxyphenyl)-1-(2,5-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 114964656 |
| Molecular Formula | C15H11BrCl2O2 |
| Molecular Weight | 374.06 g/mol |
| Exact Mass | 371.93 |
| IUPAC Name | 2-(3-bromo-4-methoxyphenyl)-1-(2,5-dichlorophenyl)ethanone |
| SMILES | COc1ccc(CC(=O)c2cc(Cl)ccc2Cl)cc1Br |
| InChI | InChI=1S/C15H11BrCl2O2/c1-20-15-5-2-9(6-12(15)16)7-14(19)11-8-10(17)3-4-13(11)18/h2-6,8H,7H2,1H3 |
| InChIKey | URPFKAVLBGVPBK-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.06 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |