C16H14BrClO4 — CID 26213000
(2-bromo-4-chlorophenyl) 2-(3,4-dimethoxyphenyl)acetate (PubChem CID 26213000) has the molecular formula C16H14BrClO4 and a molecular weight of 385.64 g/mol. Its IUPAC name is (2-bromo-4-chlorophenyl) 2-(3,4-dimethoxyphenyl)acetate.
| Compound Name | (2-bromo-4-chlorophenyl) 2-(3,4-dimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 26213000 |
| Molecular Formula | C16H14BrClO4 |
| Molecular Weight | 385.64 g/mol |
| Exact Mass | 383.98 |
| IUPAC Name | (2-bromo-4-chlorophenyl) 2-(3,4-dimethoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)Oc2ccc(Cl)cc2Br)cc1OC |
| InChI | InChI=1S/C16H14BrClO4/c1-20-14-5-3-10(7-15(14)21-2)8-16(19)22-13-6-4-11(18)9-12(13)17/h3-7,9H,8H2,1-2H3 |
| InChIKey | CWYUMMQHKUGJAE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.64 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|