C16H14BrClO3 — CID 107956974
1-(3-bromo-5-chlorophenyl)-2-(3,4-dimethoxyphenyl)ethanone (PubChem CID 107956974) has the molecular formula C16H14BrClO3 and a molecular weight of 369.64 g/mol. Its IUPAC name is 1-(3-bromo-5-chlorophenyl)-2-(3,4-dimethoxyphenyl)ethanone.
| Compound Name | 1-(3-bromo-5-chlorophenyl)-2-(3,4-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 107956974 |
| Molecular Formula | C16H14BrClO3 |
| Molecular Weight | 369.64 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | 1-(3-bromo-5-chlorophenyl)-2-(3,4-dimethoxyphenyl)ethanone |
| SMILES | COc1ccc(CC(=O)c2cc(Cl)cc(Br)c2)cc1OC |
| InChI | InChI=1S/C16H14BrClO3/c1-20-15-4-3-10(6-16(15)21-2)5-14(19)11-7-12(17)9-13(18)8-11/h3-4,6-9H,5H2,1-2H3 |
| InChIKey | ARTRHURJGMJEHE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.64 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |