C14H12Cl2O3S — CID 43344752
1-(2,5-dichlorothiophen-3-yl)-2-(3,4-dimethoxyphenyl)ethanone (PubChem CID 43344752) has the molecular formula C14H12Cl2O3S and a molecular weight of 331.22 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)-2-(3,4-dimethoxyphenyl)ethanone.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)-2-(3,4-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 43344752 |
| Molecular Formula | C14H12Cl2O3S |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)-2-(3,4-dimethoxyphenyl)ethanone |
| SMILES | COc1ccc(CC(=O)c2cc(Cl)sc2Cl)cc1OC |
| InChI | InChI=1S/C14H12Cl2O3S/c1-18-11-4-3-8(6-12(11)19-2)5-10(17)9-7-13(15)20-14(9)16/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | GZWOHHDFAPXONX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |