C14H12BrClO3S — CID 102826940
1-(4-bromo-5-chlorothiophen-2-yl)-2-(3,4-dimethoxyphenyl)ethanone (PubChem CID 102826940) has the molecular formula C14H12BrClO3S and a molecular weight of 375.67 g/mol. Its IUPAC name is 1-(4-bromo-5-chlorothiophen-2-yl)-2-(3,4-dimethoxyphenyl)ethanone.
| Compound Name | 1-(4-bromo-5-chlorothiophen-2-yl)-2-(3,4-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 102826940 |
| Molecular Formula | C14H12BrClO3S |
| Molecular Weight | 375.67 g/mol |
| Exact Mass | 373.94 |
| IUPAC Name | 1-(4-bromo-5-chlorothiophen-2-yl)-2-(3,4-dimethoxyphenyl)ethanone |
| SMILES | COc1ccc(CC(=O)c2cc(Br)c(Cl)s2)cc1OC |
| InChI | InChI=1S/C14H12BrClO3S/c1-18-11-4-3-8(6-12(11)19-2)5-10(17)13-7-9(15)14(16)20-13/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | SMFRHCQMTRTTIU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.67 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |