C14H13IO3S — CID 79693880
2-(3,4-dimethoxyphenyl)-1-(5-iodothiophen-3-yl)ethanone (PubChem CID 79693880) has the molecular formula C14H13IO3S and a molecular weight of 388.23 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1-(5-iodothiophen-3-yl)ethanone.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1-(5-iodothiophen-3-yl)ethanone |
|---|---|
| PubChem CID | 79693880 |
| Molecular Formula | C14H13IO3S |
| Molecular Weight | 388.23 g/mol |
| Exact Mass | 387.96 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1-(5-iodothiophen-3-yl)ethanone |
| SMILES | COc1ccc(CC(=O)c2csc(I)c2)cc1OC |
| InChI | InChI=1S/C14H13IO3S/c1-17-12-4-3-9(6-13(12)18-2)5-11(16)10-7-14(15)19-8-10/h3-4,6-8H,5H2,1-2H3 |
| InChIKey | BKXWHLMXMQZAFP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.23 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|