C12H14O5 — CID 69126114
1-(3,4-dimethoxyphenyl)-4-hydroxybutane-2,3-dione (PubChem CID 69126114) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-4-hydroxybutane-2,3-dione.
| Compound Name | 1-(3,4-dimethoxyphenyl)-4-hydroxybutane-2,3-dione |
|---|---|
| PubChem CID | 69126114 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-4-hydroxybutane-2,3-dione |
| SMILES | COc1ccc(CC(=O)C(=O)CO)cc1OC |
| InChI | InChI=1S/C12H14O5/c1-16-11-4-3-8(6-12(11)17-2)5-9(14)10(15)7-13/h3-4,6,13H,5,7H2,1-2H3 |
| InChIKey | MHYWGAAZNQNSGA-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|