C12H16N2O4 — CID 799227
N'-acetyl-2-(3,4-dimethoxyphenyl)acetohydrazide (PubChem CID 799227) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is N'-acetyl-2-(3,4-dimethoxyphenyl)acetohydrazide.
| Compound Name | N'-acetyl-2-(3,4-dimethoxyphenyl)acetohydrazide |
|---|---|
| PubChem CID | 799227 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N'-acetyl-2-(3,4-dimethoxyphenyl)acetohydrazide |
| SMILES | COc1ccc(CC(=O)NNC(C)=O)cc1OC |
| InChI | InChI=1S/C12H16N2O4/c1-8(15)13-14-12(16)7-9-4-5-10(17-2)11(6-9)18-3/h4-6H,7H2,1-3H3,(H,13,15)(H,14,16) |
| InChIKey | HAPWEBQEVIWNES-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|