C19H23N3O5 — CID 55350938
2-(3,4-dimethoxyphenyl)-N'-[2-(4-methoxyanilino)acetyl]acetohydrazide (PubChem CID 55350938) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N'-[2-(4-methoxyanilino)acetyl]acetohydrazide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N'-[2-(4-methoxyanilino)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 55350938 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N'-[2-(4-methoxyanilino)acetyl]acetohydrazide |
| SMILES | COc1ccc(NCC(=O)NNC(=O)Cc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C19H23N3O5/c1-25-15-7-5-14(6-8-15)20-12-19(24)22-21-18(23)11-13-4-9-16(26-2)17(10-13)27-3/h4-10,20H,11-12H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | YTTCGUCQNGBYLM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|