C18H21N3O5 — CID 55361417
2,5-dimethoxy-N'-[2-(4-methoxyanilino)acetyl]benzohydrazide (PubChem CID 55361417) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is 2,5-dimethoxy-N'-[2-(4-methoxyanilino)acetyl]benzohydrazide.
| Compound Name | 2,5-dimethoxy-N'-[2-(4-methoxyanilino)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 55361417 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 2,5-dimethoxy-N'-[2-(4-methoxyanilino)acetyl]benzohydrazide |
| SMILES | COc1ccc(NCC(=O)NNC(=O)c2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C18H21N3O5/c1-24-13-6-4-12(5-7-13)19-11-17(22)20-21-18(23)15-10-14(25-2)8-9-16(15)26-3/h4-10,19H,11H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | UEJJYPIGUVMPHE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|