C18H22N4O4 — CID 55350767
4-acetyl-N'-[2-(4-methoxyanilino)acetyl]-3,5-dimethyl-1H-pyrrole-2-carbohydrazide (PubChem CID 55350767) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is 4-acetyl-N'-[2-(4-methoxyanilino)acetyl]-3,5-dimethyl-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-acetyl-N'-[2-(4-methoxyanilino)acetyl]-3,5-dimethyl-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 55350767 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 4-acetyl-N'-[2-(4-methoxyanilino)acetyl]-3,5-dimethyl-1H-pyrrole-2-carbohydrazide |
| SMILES | COc1ccc(NCC(=O)NNC(=O)c2[nH]c(C)c(C(C)=O)c2C)cc1 |
| InChI | InChI=1S/C18H22N4O4/c1-10-16(12(3)23)11(2)20-17(10)18(25)22-21-15(24)9-19-13-5-7-14(26-4)8-6-13/h5-8,19-20H,9H2,1-4H3,(H,21,24)(H,22,25) |
| InChIKey | GAKDHXMPCRADLG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|