C19H18ClN5O3 — CID 55497230
5-(4-chlorophenyl)-N'-[2-(4-methoxyanilino)acetyl]-1H-pyrazole-4-carbohydrazide (PubChem CID 55497230) has the molecular formula C19H18ClN5O3 and a molecular weight of 399.84 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N'-[2-(4-methoxyanilino)acetyl]-1H-pyrazole-4-carbohydrazide.
| Compound Name | 5-(4-chlorophenyl)-N'-[2-(4-methoxyanilino)acetyl]-1H-pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 55497230 |
| Molecular Formula | C19H18ClN5O3 |
| Molecular Weight | 399.84 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 5-(4-chlorophenyl)-N'-[2-(4-methoxyanilino)acetyl]-1H-pyrazole-4-carbohydrazide |
| SMILES | COc1ccc(NCC(=O)NNC(=O)c2cn[nH]c2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H18ClN5O3/c1-28-15-8-6-14(7-9-15)21-11-17(26)23-25-19(27)16-10-22-24-18(16)12-2-4-13(20)5-3-12/h2-10,21H,11H2,1H3,(H,22,24)(H,23,26)(H,25,27) |
| InChIKey | AXEZYYFHQVQQSF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 108.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.84 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|