C17H17Cl2N3O4 — CID 18206228
N'-[2-(2,5-dichlorophenoxy)acetyl]-2-(4-methoxyanilino)acetohydrazide (PubChem CID 18206228) has the molecular formula C17H17Cl2N3O4 and a molecular weight of 398.25 g/mol. Its IUPAC name is N'-[2-(2,5-dichlorophenoxy)acetyl]-2-(4-methoxyanilino)acetohydrazide.
| Compound Name | N'-[2-(2,5-dichlorophenoxy)acetyl]-2-(4-methoxyanilino)acetohydrazide |
|---|---|
| PubChem CID | 18206228 |
| Molecular Formula | C17H17Cl2N3O4 |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | N'-[2-(2,5-dichlorophenoxy)acetyl]-2-(4-methoxyanilino)acetohydrazide |
| SMILES | COc1ccc(NCC(=O)NNC(=O)COc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C17H17Cl2N3O4/c1-25-13-5-3-12(4-6-13)20-9-16(23)21-22-17(24)10-26-15-8-11(18)2-7-14(15)19/h2-8,20H,9-10H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | RBNWRBMGWKWOFA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|