C21H27N3O4 — CID 55351010
2-(4-methoxyanilino)-N'-[2-(2-methyl-5-propan-2-ylphenoxy)acetyl]acetohydrazide (PubChem CID 55351010) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 2-(4-methoxyanilino)-N'-[2-(2-methyl-5-propan-2-ylphenoxy)acetyl]acetohydrazide.
| Compound Name | 2-(4-methoxyanilino)-N'-[2-(2-methyl-5-propan-2-ylphenoxy)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 55351010 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 2-(4-methoxyanilino)-N'-[2-(2-methyl-5-propan-2-ylphenoxy)acetyl]acetohydrazide |
| SMILES | COc1ccc(NCC(=O)NNC(=O)COc2cc(C(C)C)ccc2C)cc1 |
| InChI | InChI=1S/C21H27N3O4/c1-14(2)16-6-5-15(3)19(11-16)28-13-21(26)24-23-20(25)12-22-17-7-9-18(27-4)10-8-17/h5-11,14,22H,12-13H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | NEPFBNWCJOQWRO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|