C25H28N2O5S — CID 3649470
N-[2-[5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2-methyl-5-propan-2-ylphenoxy)acetamide (PubChem CID 3649470) has the molecular formula C25H28N2O5S and a molecular weight of 468.58 g/mol. Its IUPAC name is N-[2-[5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2-methyl-5-propan-2-ylphenoxy)acetamide.
| Compound Name | N-[2-[5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2-methyl-5-propan-2-ylphenoxy)acetamide |
|---|---|
| PubChem CID | 3649470 |
| Molecular Formula | C25H28N2O5S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | N-[2-[5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2-methyl-5-propan-2-ylphenoxy)acetamide |
| SMILES | COc1ccc(C=C2SC(=O)N(CCNC(=O)COc3cc(C(C)C)ccc3C)C2=O)cc1 |
| InChI | InChI=1S/C25H28N2O5S/c1-16(2)19-8-5-17(3)21(14-19)32-15-23(28)26-11-12-27-24(29)22(33-25(27)30)13-18-6-9-20(31-4)10-7-18/h5-10,13-14,16H,11-12,15H2,1-4H3,(H,26,28) |
| InChIKey | KHZIEHBBBQKLQR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|