C22H19N3O5S — CID 2582868
2-(2-cyanophenoxy)-N-[2-[(5Z)-5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide (PubChem CID 2582868) has the molecular formula C22H19N3O5S and a molecular weight of 437.48 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-N-[2-[(5Z)-5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide.
| Compound Name | 2-(2-cyanophenoxy)-N-[2-[(5Z)-5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 2582868 |
| Molecular Formula | C22H19N3O5S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 2-(2-cyanophenoxy)-N-[2-[(5Z)-5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide |
| SMILES | COc1ccc(/C=C2\SC(=O)N(CCNC(=O)COc3ccccc3C#N)C2=O)cc1 |
| InChI | InChI=1S/C22H19N3O5S/c1-29-17-8-6-15(7-9-17)12-19-21(27)25(22(28)31-19)11-10-24-20(26)14-30-18-5-3-2-4-16(18)13-23/h2-9,12H,10-11,14H2,1H3,(H,24,26)/b19-12- |
| InChIKey | XOMJFBHABODULV-UNOMPAQXSA-N |
| XLogP | 2.80 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|