C16H15Cl2N3O3 — CID 46518487
2-(2,5-dichlorophenoxy)-N-[4-(methylcarbamoylamino)phenyl]acetamide (PubChem CID 46518487) has the molecular formula C16H15Cl2N3O3 and a molecular weight of 368.22 g/mol. Its IUPAC name is 2-(2,5-dichlorophenoxy)-N-[4-(methylcarbamoylamino)phenyl]acetamide.
| Compound Name | 2-(2,5-dichlorophenoxy)-N-[4-(methylcarbamoylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 46518487 |
| Molecular Formula | C16H15Cl2N3O3 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | 2-(2,5-dichlorophenoxy)-N-[4-(methylcarbamoylamino)phenyl]acetamide |
| SMILES | CNC(=O)Nc1ccc(NC(=O)COc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C16H15Cl2N3O3/c1-19-16(23)21-12-5-3-11(4-6-12)20-15(22)9-24-14-8-10(17)2-7-13(14)18/h2-8H,9H2,1H3,(H,20,22)(H2,19,21,23) |
| InChIKey | WOWBWXLZDSIPHO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |