C18H19Cl2N3O3 — CID 110615374
2-[[2-(2,5-dichlorophenoxy)acetyl]amino]-N-[4-(dimethylamino)phenyl]acetamide (PubChem CID 110615374) has the molecular formula C18H19Cl2N3O3 and a molecular weight of 396.27 g/mol. Its IUPAC name is 2-[[2-(2,5-dichlorophenoxy)acetyl]amino]-N-[4-(dimethylamino)phenyl]acetamide.
| Compound Name | 2-[[2-(2,5-dichlorophenoxy)acetyl]amino]-N-[4-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 110615374 |
| Molecular Formula | C18H19Cl2N3O3 |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 2-[[2-(2,5-dichlorophenoxy)acetyl]amino]-N-[4-(dimethylamino)phenyl]acetamide |
| SMILES | CN(C)c1ccc(NC(=O)CNC(=O)COc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C18H19Cl2N3O3/c1-23(2)14-6-4-13(5-7-14)22-17(24)10-21-18(25)11-26-16-9-12(19)3-8-15(16)20/h3-9H,10-11H2,1-2H3,(H,21,25)(H,22,24) |
| InChIKey | RMIUCMBCCMNGGT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|