C18H17Cl2NO5 — CID 19169315
2-methoxyethyl 4-[[2-(2,5-dichlorophenoxy)acetyl]amino]benzoate (PubChem CID 19169315) has the molecular formula C18H17Cl2NO5 and a molecular weight of 398.24 g/mol. Its IUPAC name is 2-methoxyethyl 4-[[2-(2,5-dichlorophenoxy)acetyl]amino]benzoate.
| Compound Name | 2-methoxyethyl 4-[[2-(2,5-dichlorophenoxy)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 19169315 |
| Molecular Formula | C18H17Cl2NO5 |
| Molecular Weight | 398.24 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 2-methoxyethyl 4-[[2-(2,5-dichlorophenoxy)acetyl]amino]benzoate |
| SMILES | COCCOC(=O)c1ccc(NC(=O)COc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C18H17Cl2NO5/c1-24-8-9-25-18(23)12-2-5-14(6-3-12)21-17(22)11-26-16-10-13(19)4-7-15(16)20/h2-7,10H,8-9,11H2,1H3,(H,21,22) |
| InChIKey | FDQCXWJHNDRMFB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.24 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|