C18H17Cl2NO4 — CID 7185050
propyl 4-[[2-(2,5-dichlorophenoxy)acetyl]amino]benzoate (PubChem CID 7185050) has the molecular formula C18H17Cl2NO4 and a molecular weight of 382.24 g/mol. Its IUPAC name is propyl 4-[[2-(2,5-dichlorophenoxy)acetyl]amino]benzoate.
| Compound Name | propyl 4-[[2-(2,5-dichlorophenoxy)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 7185050 |
| Molecular Formula | C18H17Cl2NO4 |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | propyl 4-[[2-(2,5-dichlorophenoxy)acetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)COc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C18H17Cl2NO4/c1-2-9-24-18(23)12-3-6-14(7-4-12)21-17(22)11-25-16-10-13(19)5-8-15(16)20/h3-8,10H,2,9,11H2,1H3,(H,21,22) |
| InChIKey | WUMCMKRCGNORKP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |