C20H21ClN2O4S — CID 7732137
propyl 4-[[2-[2-(4-chloroanilino)-2-oxoethyl]sulfanylacetyl]amino]benzoate (PubChem CID 7732137) has the molecular formula C20H21ClN2O4S and a molecular weight of 420.92 g/mol. Its IUPAC name is propyl 4-[[2-[2-(4-chloroanilino)-2-oxoethyl]sulfanylacetyl]amino]benzoate.
| Compound Name | propyl 4-[[2-[2-(4-chloroanilino)-2-oxoethyl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 7732137 |
| Molecular Formula | C20H21ClN2O4S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | propyl 4-[[2-[2-(4-chloroanilino)-2-oxoethyl]sulfanylacetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)CSCC(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H21ClN2O4S/c1-2-11-27-20(26)14-3-7-16(8-4-14)22-18(24)12-28-13-19(25)23-17-9-5-15(21)6-10-17/h3-10H,2,11-13H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | IPZFAHGWAYVDBQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |