C19H20ClNO3 — CID 19220847
propyl 4-[3-(4-chlorophenyl)propanoylamino]benzoate (PubChem CID 19220847) has the molecular formula C19H20ClNO3 and a molecular weight of 345.83 g/mol. Its IUPAC name is propyl 4-[3-(4-chlorophenyl)propanoylamino]benzoate.
| Compound Name | propyl 4-[3-(4-chlorophenyl)propanoylamino]benzoate |
|---|---|
| PubChem CID | 19220847 |
| Molecular Formula | C19H20ClNO3 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | propyl 4-[3-(4-chlorophenyl)propanoylamino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)CCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H20ClNO3/c1-2-13-24-19(23)15-6-10-17(11-7-15)21-18(22)12-5-14-3-8-16(20)9-4-14/h3-4,6-11H,2,5,12-13H2,1H3,(H,21,22) |
| InChIKey | FKMWTIVGTXHSFX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |