C19H20BrNO6 — CID 55453302
2-methoxyethyl 4-[2-(4-bromoanilino)-2-oxoethoxy]-3-methoxybenzoate (PubChem CID 55453302) has the molecular formula C19H20BrNO6 and a molecular weight of 438.27 g/mol. Its IUPAC name is 2-methoxyethyl 4-[2-(4-bromoanilino)-2-oxoethoxy]-3-methoxybenzoate.
| Compound Name | 2-methoxyethyl 4-[2-(4-bromoanilino)-2-oxoethoxy]-3-methoxybenzoate |
|---|---|
| PubChem CID | 55453302 |
| Molecular Formula | C19H20BrNO6 |
| Molecular Weight | 438.27 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | 2-methoxyethyl 4-[2-(4-bromoanilino)-2-oxoethoxy]-3-methoxybenzoate |
| SMILES | COCCOC(=O)c1ccc(OCC(=O)Nc2ccc(Br)cc2)c(OC)c1 |
| InChI | InChI=1S/C19H20BrNO6/c1-24-9-10-26-19(23)13-3-8-16(17(11-13)25-2)27-12-18(22)21-15-6-4-14(20)5-7-15/h3-8,11H,9-10,12H2,1-2H3,(H,21,22) |
| InChIKey | RIWQODUKTGQWDV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|