C19H18BrNO7 — CID 55354796
(2-methoxy-2-oxoethyl) 4-[2-(4-bromoanilino)-2-oxoethoxy]-3-methoxybenzoate (PubChem CID 55354796) has the molecular formula C19H18BrNO7 and a molecular weight of 452.26 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) 4-[2-(4-bromoanilino)-2-oxoethoxy]-3-methoxybenzoate.
| Compound Name | (2-methoxy-2-oxoethyl) 4-[2-(4-bromoanilino)-2-oxoethoxy]-3-methoxybenzoate |
|---|---|
| PubChem CID | 55354796 |
| Molecular Formula | C19H18BrNO7 |
| Molecular Weight | 452.26 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | (2-methoxy-2-oxoethyl) 4-[2-(4-bromoanilino)-2-oxoethoxy]-3-methoxybenzoate |
| SMILES | COC(=O)COC(=O)c1ccc(OCC(=O)Nc2ccc(Br)cc2)c(OC)c1 |
| InChI | InChI=1S/C19H18BrNO7/c1-25-16-9-12(19(24)28-11-18(23)26-2)3-8-15(16)27-10-17(22)21-14-6-4-13(20)5-7-14/h3-9H,10-11H2,1-2H3,(H,21,22) |
| InChIKey | OLSSHTUERYROIW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |