C21H21FN2O6 — CID 18074118
[2-oxo-2-(prop-2-enylamino)ethyl] 4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxybenzoate (PubChem CID 18074118) has the molecular formula C21H21FN2O6 and a molecular weight of 416.41 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylamino)ethyl] 4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxybenzoate.
| Compound Name | [2-oxo-2-(prop-2-enylamino)ethyl] 4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxybenzoate |
|---|---|
| PubChem CID | 18074118 |
| Molecular Formula | C21H21FN2O6 |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | [2-oxo-2-(prop-2-enylamino)ethyl] 4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxybenzoate |
| SMILES | C=CCNC(=O)COC(=O)c1ccc(OCC(=O)Nc2ccc(F)cc2)c(OC)c1 |
| InChI | InChI=1S/C21H21FN2O6/c1-3-10-23-19(25)12-30-21(27)14-4-9-17(18(11-14)28-2)29-13-20(26)24-16-7-5-15(22)6-8-16/h3-9,11H,1,10,12-13H2,2H3,(H,23,25)(H,24,26) |
| InChIKey | UQJWOZKMCRUZAL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|