C23H19F2NO5 — CID 18229658
(3-fluorophenyl)methyl 4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxybenzoate (PubChem CID 18229658) has the molecular formula C23H19F2NO5 and a molecular weight of 427.40 g/mol. Its IUPAC name is (3-fluorophenyl)methyl 4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxybenzoate.
| Compound Name | (3-fluorophenyl)methyl 4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxybenzoate |
|---|---|
| PubChem CID | 18229658 |
| Molecular Formula | C23H19F2NO5 |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | (3-fluorophenyl)methyl 4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OCc2cccc(F)c2)ccc1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C23H19F2NO5/c1-29-21-12-16(23(28)31-13-15-3-2-4-18(25)11-15)5-10-20(21)30-14-22(27)26-19-8-6-17(24)7-9-19/h2-12H,13-14H2,1H3,(H,26,27) |
| InChIKey | OWBKVXLXIKYKCT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |