C26H21FN2O7 — CID 2124108
2-(1,3-dioxoisoindol-2-yl)ethyl 4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxybenzoate (PubChem CID 2124108) has the molecular formula C26H21FN2O7 and a molecular weight of 492.46 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxybenzoate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxybenzoate |
|---|---|
| PubChem CID | 2124108 |
| Molecular Formula | C26H21FN2O7 |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OCCN2C(=O)c3ccccc3C2=O)ccc1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C26H21FN2O7/c1-34-22-14-16(6-11-21(22)36-15-23(30)28-18-9-7-17(27)8-10-18)26(33)35-13-12-29-24(31)19-4-2-3-5-20(19)25(29)32/h2-11,14H,12-13,15H2,1H3,(H,28,30) |
| InChIKey | GWLQBBBAGDGDRO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|