C18H14FNO5 — CID 7991343
2-(1,3-dioxoisoindol-2-yl)ethyl 3-fluoro-4-methoxybenzoate (PubChem CID 7991343) has the molecular formula C18H14FNO5 and a molecular weight of 343.31 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 3-fluoro-4-methoxybenzoate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 3-fluoro-4-methoxybenzoate |
|---|---|
| PubChem CID | 7991343 |
| Molecular Formula | C18H14FNO5 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 3-fluoro-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCCN2C(=O)c3ccccc3C2=O)cc1F |
| InChI | InChI=1S/C18H14FNO5/c1-24-15-7-6-11(10-14(15)19)18(23)25-9-8-20-16(21)12-4-2-3-5-13(12)17(20)22/h2-7,10H,8-9H2,1H3 |
| InChIKey | SISWXEUNBKWYBC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|