C18H13F2NO5 — CID 2629528
2-(1,3-dioxoisoindol-2-yl)ethyl 4-(difluoromethoxy)benzoate (PubChem CID 2629528) has the molecular formula C18H13F2NO5 and a molecular weight of 361.30 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 4-(difluoromethoxy)benzoate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 4-(difluoromethoxy)benzoate |
|---|---|
| PubChem CID | 2629528 |
| Molecular Formula | C18H13F2NO5 |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 4-(difluoromethoxy)benzoate |
| SMILES | O=C(OCCN1C(=O)c2ccccc2C1=O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H13F2NO5/c19-18(20)26-12-7-5-11(6-8-12)17(24)25-10-9-21-15(22)13-3-1-2-4-14(13)16(21)23/h1-8,18H,9-10H2 |
| InChIKey | NNKYCEWYRHETCP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|